C15H19N3 — CID 170866043
N,N-dimethyl-3-(4-pyrimidin-2-ylphenyl)propan-1-amine (PubChem CID 170866043) has the molecular formula C15H19N3 and a molecular weight of 241.34 g/mol. Its IUPAC name is N,N-dimethyl-3-(4-pyrimidin-2-ylphenyl)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(4-pyrimidin-2-ylphenyl)propan-1-amine |
|---|---|
| PubChem CID | 170866043 |
| Molecular Formula | C15H19N3 |
| Molecular Weight | 241.34 g/mol |
| Exact Mass | 241.16 |
| IUPAC Name | N,N-dimethyl-3-(4-pyrimidin-2-ylphenyl)propan-1-amine |
| SMILES | CN(C)CCCc1ccc(-c2ncccn2)cc1 |
| InChI | InChI=1S/C15H19N3/c1-18(2)12-3-5-13-6-8-14(9-7-13)15-16-10-4-11-17-15/h4,6-11H,3,5,12H2,1-2H3 |
| InChIKey | SQUOJGYWWJGMSH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |