C12H20OS — CID 143453852
(Z)-3,4-dimethyl-5-(2-methylprop-2-enylsulfanyl)hex-3-en-2-one (PubChem CID 143453852) has the molecular formula C12H20OS and a molecular weight of 212.36 g/mol. Its IUPAC name is (Z)-3,4-dimethyl-5-(2-methylprop-2-enylsulfanyl)hex-3-en-2-one.
| Compound Name | (Z)-3,4-dimethyl-5-(2-methylprop-2-enylsulfanyl)hex-3-en-2-one |
|---|---|
| PubChem CID | 143453852 |
| Molecular Formula | C12H20OS |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (Z)-3,4-dimethyl-5-(2-methylprop-2-enylsulfanyl)hex-3-en-2-one |
| SMILES | C=C(C)CSC(C)/C(C)=C(/C)C(C)=O |
| InChI | InChI=1S/C12H20OS/c1-8(2)7-14-12(6)10(4)9(3)11(5)13/h12H,1,7H2,2-6H3/b10-9- |
| InChIKey | NGAFZWUWOXYUDS-KTKRTIGZSA-N |
| XLogP | 3.61 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|