C15H22N2OS2 — CID 67706328
N-[2-(2-amino-3-sulfanylphenyl)ethyl]-2-(2-methylprop-2-enylsulfanyl)propanamide (PubChem CID 67706328) has the molecular formula C15H22N2OS2 and a molecular weight of 310.49 g/mol. Its IUPAC name is N-[2-(2-amino-3-sulfanylphenyl)ethyl]-2-(2-methylprop-2-enylsulfanyl)propanamide.
| Compound Name | N-[2-(2-amino-3-sulfanylphenyl)ethyl]-2-(2-methylprop-2-enylsulfanyl)propanamide |
|---|---|
| PubChem CID | 67706328 |
| Molecular Formula | C15H22N2OS2 |
| Molecular Weight | 310.49 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | N-[2-(2-amino-3-sulfanylphenyl)ethyl]-2-(2-methylprop-2-enylsulfanyl)propanamide |
| SMILES | C=C(C)CSC(C)C(=O)NCCc1cccc(S)c1N |
| InChI | InChI=1S/C15H22N2OS2/c1-10(2)9-20-11(3)15(18)17-8-7-12-5-4-6-13(19)14(12)16/h4-6,11,19H,1,7-9,16H2,2-3H3,(H,17,18) |
| InChIKey | WNZIZUFWEKKGOL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.49 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|