C14H13N3OS — CID 1434539
3-benzyl-5,6-dimethylthieno[2,3-d]triazin-4-one (PubChem CID 1434539) has the molecular formula C14H13N3OS and a molecular weight of 271.34 g/mol. Its IUPAC name is 3-benzyl-5,6-dimethylthieno[2,3-d]triazin-4-one.
| Compound Name | 3-benzyl-5,6-dimethylthieno[2,3-d]triazin-4-one |
|---|---|
| PubChem CID | 1434539 |
| Molecular Formula | C14H13N3OS |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 3-benzyl-5,6-dimethylthieno[2,3-d]triazin-4-one |
| SMILES | Cc1sc2nnn(Cc3ccccc3)c(=O)c2c1C |
| InChI | InChI=1S/C14H13N3OS/c1-9-10(2)19-13-12(9)14(18)17(16-15-13)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | KEMPERFMJHPYKZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |