C22H22N4OS2 — CID 167795225
3-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 167795225) has the molecular formula C22H22N4OS2 and a molecular weight of 422.58 g/mol. Its IUPAC name is 3-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 167795225 |
| Molecular Formula | C22H22N4OS2 |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 3-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | C#CCCC1(CCSc2nc3sc(C)c(C)c3c(=O)n2Cc2ccccc2)N=N1 |
| InChI | InChI=1S/C22H22N4OS2/c1-4-5-11-22(24-25-22)12-13-28-21-23-19-18(15(2)16(3)29-19)20(27)26(21)14-17-9-7-6-8-10-17/h1,6-10H,5,11-14H2,2-3H3 |
| InChIKey | OYFYWNJFZUCLHX-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 59.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|