C21H19ClN4S — CID 166429490
1-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-chlorobenzimidazole (PubChem CID 166429490) has the molecular formula C21H19ClN4S and a molecular weight of 394.93 g/mol. Its IUPAC name is 1-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-chlorobenzimidazole.
| Compound Name | 1-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-chlorobenzimidazole |
|---|---|
| PubChem CID | 166429490 |
| Molecular Formula | C21H19ClN4S |
| Molecular Weight | 394.93 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-benzyl-2-[2-(3-but-3-ynyldiazirin-3-yl)ethylsulfanyl]-5-chlorobenzimidazole |
| SMILES | C#CCCC1(CCSc2nc3cc(Cl)ccc3n2Cc2ccccc2)N=N1 |
| InChI | InChI=1S/C21H19ClN4S/c1-2-3-11-21(24-25-21)12-13-27-20-23-18-14-17(22)9-10-19(18)26(20)15-16-7-5-4-6-8-16/h1,4-10,14H,3,11-13,15H2 |
| InChIKey | UCOZEPAFBQWQDD-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 42.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.93 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|