C20H27NO5 — CID 143454776
ethane;6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid (PubChem CID 143454776) has the molecular formula C20H27NO5 and a molecular weight of 361.44 g/mol. Its IUPAC name is ethane;6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid.
| Compound Name | ethane;6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143454776 |
| Molecular Formula | C20H27NO5 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | ethane;6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid |
| SMILES | CC.CC(C)n1cc(C(=O)O)c(=O)c2cc(C/C=C/OCCO)ccc21 |
| InChI | InChI=1S/C18H21NO5.C2H6/c1-12(2)19-11-15(18(22)23)17(21)14-10-13(5-6-16(14)19)4-3-8-24-9-7-20;1-2/h3,5-6,8,10-12,20H,4,7,9H2,1-2H3,(H,22,23);1-2H3/b8-3+; |
| InChIKey | FKBUIBXTKCNAHO-DCDCITSCSA-N |
| XLogP | 3.37 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|