C18H21NO5 — CID 143454777
6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid (PubChem CID 143454777) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid.
| Compound Name | 6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 143454777 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 6-[(E)-3-(2-hydroxyethoxy)prop-2-enyl]-4-oxo-1-propan-2-ylquinoline-3-carboxylic acid |
| SMILES | CC(C)n1cc(C(=O)O)c(=O)c2cc(C/C=C/OCCO)ccc21 |
| InChI | InChI=1S/C18H21NO5/c1-12(2)19-11-15(18(22)23)17(21)14-10-13(5-6-16(14)19)4-3-8-24-9-7-20/h3,5-6,8,10-12,20H,4,7,9H2,1-2H3,(H,22,23)/b8-3+ |
| InChIKey | UBYGPJZKERVMIF-FPYGCLRLSA-N |
| XLogP | 2.35 |
| TPSA | 88.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|