C19H23NO3S — CID 143455921
2-[(S)-(2,3-dimethoxyphenyl)-[4-methyl-2-(methylamino)phenyl]methoxy]ethanethial (PubChem CID 143455921) has the molecular formula C19H23NO3S and a molecular weight of 345.46 g/mol. Its IUPAC name is 2-[(S)-(2,3-dimethoxyphenyl)-[4-methyl-2-(methylamino)phenyl]methoxy]ethanethial.
| Compound Name | 2-[(S)-(2,3-dimethoxyphenyl)-[4-methyl-2-(methylamino)phenyl]methoxy]ethanethial |
|---|---|
| PubChem CID | 143455921 |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | 2-[(S)-(2,3-dimethoxyphenyl)-[4-methyl-2-(methylamino)phenyl]methoxy]ethanethial |
| SMILES | CNc1cc(C)ccc1[C@H](OCC=S)c1cccc(OC)c1OC |
| InChI | InChI=1S/C19H23NO3S/c1-13-8-9-14(16(12-13)20-2)18(23-10-11-24)15-6-5-7-17(21-3)19(15)22-4/h5-9,11-12,18,20H,10H2,1-4H3/t18-/m0/s1 |
| InChIKey | STBJRPJVFMJMGS-SFHVURJKSA-N |
| XLogP | 4.16 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|