C10H24B2O4 — CID 143456732
dimethoxy(methyl)borane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane (PubChem CID 143456732) has the molecular formula C10H24B2O4 and a molecular weight of 229.92 g/mol. Its IUPAC name is dimethoxy(methyl)borane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane.
| Compound Name | dimethoxy(methyl)borane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 143456732 |
| Molecular Formula | C10H24B2O4 |
| Molecular Weight | 229.92 g/mol |
| Exact Mass | 230.19 |
| IUPAC Name | dimethoxy(methyl)borane;2,4,4,5,5-pentamethyl-1,3,2-dioxaborolane |
| SMILES | CB1OC(C)(C)C(C)(C)O1.COB(C)OC |
| InChI | InChI=1S/C7H15BO2.C3H9BO2/c1-6(2)7(3,4)10-8(5)9-6;1-4(5-2)6-3/h1-5H3;1-3H3 |
| InChIKey | GOQRUUAIKRYIKO-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.92 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|