C31H36N8O — CID 143458475
[4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]piperidin-1-yl]-piperidin-2-ylmethanone (PubChem CID 143458475) has the molecular formula C31H36N8O and a molecular weight of 536.68 g/mol. Its IUPAC name is [4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]piperidin-1-yl]-piperidin-2-ylmethanone.
| Compound Name | [4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]piperidin-1-yl]-piperidin-2-ylmethanone |
|---|---|
| PubChem CID | 143458475 |
| Molecular Formula | C31H36N8O |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.30 |
| IUPAC Name | [4-[4-amino-5-[3-amino-4-(benzyliminomethyl)phenyl]pyrrolo[2,1-f][1,2,4]triazin-7-yl]piperidin-1-yl]-piperidin-2-ylmethanone |
| SMILES | Nc1cc(-c2cc(C3CCN(C(=O)C4CCCCN4)CC3)n3ncnc(N)c23)ccc1/C=N/Cc1ccccc1 |
| InChI | InChI=1S/C31H36N8O/c32-26-16-23(9-10-24(26)19-34-18-21-6-2-1-3-7-21)25-17-28(39-29(25)30(33)36-20-37-39)22-11-14-38(15-12-22)31(40)27-8-4-5-13-35-27/h1-3,6-7,9-10,16-17,19-20,22,27,35H,4-5,8,11-15,18,32H2,(H2,33,36,37)/b34-19+ |
| InChIKey | WYEZCSOSZUVBBN-ALQBTCKLSA-N |
| XLogP | 4.03 |
| TPSA | 126.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|