C24H29NO — CID 143459909
(3E)-5-methyl-1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3-[(2Z)-1-phenylmethoxypenta-2,4-dienylidene]-2H-pyrrole (PubChem CID 143459909) has the molecular formula C24H29NO and a molecular weight of 347.50 g/mol. Its IUPAC name is (3E)-5-methyl-1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3-[(2Z)-1-phenylmethoxypenta-2,4-dienylidene]-2H-pyrrole.
| Compound Name | (3E)-5-methyl-1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3-[(2Z)-1-phenylmethoxypenta-2,4-dienylidene]-2H-pyrrole |
|---|---|
| PubChem CID | 143459909 |
| Molecular Formula | C24H29NO |
| Molecular Weight | 347.50 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | (3E)-5-methyl-1-[(2E,4Z)-2-methylhexa-2,4-dienyl]-3-[(2Z)-1-phenylmethoxypenta-2,4-dienylidene]-2H-pyrrole |
| SMILES | C=C/C=C\C(OCc1ccccc1)=C1\C=C(C)N(C/C(C)=C/C=C\C)C1 |
| InChI | InChI=1S/C24H29NO/c1-5-7-12-20(3)17-25-18-23(16-21(25)4)24(15-8-6-2)26-19-22-13-10-9-11-14-22/h5-16H,2,17-19H2,1,3-4H3/b7-5-,15-8-,20-12+,24-23+ |
| InChIKey | PRLZPBMJLZYOGT-DSPDYSGVSA-N |
| XLogP | 5.94 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|