C14H17NO2 — CID 24823553
3-butyl-4-methyl-5-phenyl-1,3-oxazol-2-one (PubChem CID 24823553) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-butyl-4-methyl-5-phenyl-1,3-oxazol-2-one.
| Compound Name | 3-butyl-4-methyl-5-phenyl-1,3-oxazol-2-one |
|---|---|
| PubChem CID | 24823553 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 3-butyl-4-methyl-5-phenyl-1,3-oxazol-2-one |
| SMILES | CCCCn1c(C)c(-c2ccccc2)oc1=O |
| InChI | InChI=1S/C14H17NO2/c1-3-4-10-15-11(2)13(17-14(15)16)12-8-6-5-7-9-12/h5-9H,3-4,10H2,1-2H3 |
| InChIKey | CICALMDNKOKMDH-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |