About Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate
Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate (PubChem CID 15197579) has the molecular formula C12H14FNO2
and a molecular weight of 223.24 g/mol. Its IUPAC name is benzyl (3S)-3-fluoropyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate |
| PubChem CID | 15197579 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | benzyl (3S)-3-fluoropyrrolidine-1-carboxylate |
| SMILES | C1CN(C[C@H]1F)C(=O)OCC2=CC=CC=C2 |
| InChI | InChI=1S/C12H14FNO2/c13-11-6-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2/t11-/m0/s1 |
| InChIKey | DGQYMNWQXVFIBE-NSHDSACASA-N |
| XLogP | 2.20 |
| TPSA | 29.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | 241 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate?
The IUPAC name of Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate (CID 15197579) is benzyl (3S)-3-fluoropyrrolidine-1-carboxylate.
What is the SMILES notation for Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate?
The canonical SMILES for Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate is C1CN(C[C@H]1F)C(=O)OCC2=CC=CC=C2.
What is the InChIKey of Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate?
The InChIKey is DGQYMNWQXVFIBE-NSHDSACASA-N. The full InChI is InChI=1S/C12H14FNO2/c13-11-6-7-14(8-11)12(15)16-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2/t11-/m0/s1.
What are the key properties of Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate?
Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate has a molecular weight of 223.24 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for Phenylmethyl (3S)-3-fluoro-1-pyrrolidinecarboxylate is sourced from PubChem (CID 15197579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).