C23H25N5O2 — CID 143464434
(Z)-N'-(3-aminophenyl)-N-[3-(1H-pyrazol-5-yl)phenyl]oct-4-enediamide (PubChem CID 143464434) has the molecular formula C23H25N5O2 and a molecular weight of 403.49 g/mol. Its IUPAC name is (Z)-N'-(3-aminophenyl)-N-[3-(1H-pyrazol-5-yl)phenyl]oct-4-enediamide.
| Compound Name | (Z)-N'-(3-aminophenyl)-N-[3-(1H-pyrazol-5-yl)phenyl]oct-4-enediamide |
|---|---|
| PubChem CID | 143464434 |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | (Z)-N'-(3-aminophenyl)-N-[3-(1H-pyrazol-5-yl)phenyl]oct-4-enediamide |
| SMILES | Nc1cccc(NC(=O)CC/C=C\CCC(=O)Nc2cccc(-c3ccn[nH]3)c2)c1 |
| InChI | InChI=1S/C23H25N5O2/c24-18-8-6-10-20(16-18)27-23(30)12-4-2-1-3-11-22(29)26-19-9-5-7-17(15-19)21-13-14-25-28-21/h1-2,5-10,13-16H,3-4,11-12,24H2,(H,25,28)(H,26,29)(H,27,30)/b2-1- |
| InChIKey | GJQYONZDLHSKKG-UPHRSURJSA-N |
| XLogP | 4.35 |
| TPSA | 112.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|