C14H16N4O — CID 79285096
2-(prop-2-enylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]acetamide (PubChem CID 79285096) has the molecular formula C14H16N4O and a molecular weight of 256.31 g/mol. Its IUPAC name is 2-(prop-2-enylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]acetamide.
| Compound Name | 2-(prop-2-enylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 79285096 |
| Molecular Formula | C14H16N4O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-(prop-2-enylamino)-N-[3-(1H-pyrazol-5-yl)phenyl]acetamide |
| SMILES | C=CCNCC(=O)Nc1cccc(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C14H16N4O/c1-2-7-15-10-14(19)17-12-5-3-4-11(9-12)13-6-8-16-18-13/h2-6,8-9,15H,1,7,10H2,(H,16,18)(H,17,19) |
| InChIKey | CGAVZSLIQFYRIS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|