C19H21N8O+ — CID 143464995
3-(2-methyl-1H-pyrazol-2-ium-4-yl)-N-[2-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 143464995) has the molecular formula C19H21N8O+ and a molecular weight of 377.43 g/mol. Its IUPAC name is 3-(2-methyl-1H-pyrazol-2-ium-4-yl)-N-[2-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-(2-methyl-1H-pyrazol-2-ium-4-yl)-N-[2-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143464995 |
| Molecular Formula | C19H21N8O+ |
| Molecular Weight | 377.43 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 3-(2-methyl-1H-pyrazol-2-ium-4-yl)-N-[2-[(3S)-pyrrolidin-3-yl]oxy-4-pyridinyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | C[n+]1cc(-c2cnc3c(Nc4ccnc(O[C@H]5CCNC5)c4)nccn23)c[nH]1 |
| InChI | InChI=1S/C19H20N8O/c1-26-12-13(9-24-26)16-11-23-19-18(22-6-7-27(16)19)25-14-2-5-21-17(8-14)28-15-3-4-20-10-15/h2,5-9,11-12,15,20H,3-4,10H2,1H3,(H,21,22,25)/p+1/t15-/m0/s1 |
| InChIKey | ZVNFLTYEQVTKCD-HNNXBMFYSA-O |
| XLogP | 1.43 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.43 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|