C17H28FNO — CID 143465427
ethane;4-[(2Z,7E)-8-fluoroocta-2,7-dien-4-yl]-1-methyl-6-methylidenepiperidin-2-one (PubChem CID 143465427) has the molecular formula C17H28FNO and a molecular weight of 281.42 g/mol. Its IUPAC name is ethane;4-[(2Z,7E)-8-fluoroocta-2,7-dien-4-yl]-1-methyl-6-methylidenepiperidin-2-one.
| Compound Name | ethane;4-[(2Z,7E)-8-fluoroocta-2,7-dien-4-yl]-1-methyl-6-methylidenepiperidin-2-one |
|---|---|
| PubChem CID | 143465427 |
| Molecular Formula | C17H28FNO |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.22 |
| IUPAC Name | ethane;4-[(2Z,7E)-8-fluoroocta-2,7-dien-4-yl]-1-methyl-6-methylidenepiperidin-2-one |
| SMILES | C=C1CC(C(/C=C\C)CC/C=C/F)CC(=O)N1C.CC |
| InChI | InChI=1S/C15H22FNO.C2H6/c1-4-7-13(8-5-6-9-16)14-10-12(2)17(3)15(18)11-14;1-2/h4,6-7,9,13-14H,2,5,8,10-11H2,1,3H3;1-2H3/b7-4-,9-6+; |
| InChIKey | WZTDEDMRBRGRNA-XEAPTMNZSA-N |
| XLogP | 4.85 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|