C17H19N5O2S — CID 143465834
3-[2-(3H-azepin-6-yl)piperidin-1-yl]sulfonyl-2H-pyrazolo[3,4-b]pyridine (PubChem CID 143465834) has the molecular formula C17H19N5O2S and a molecular weight of 357.44 g/mol. Its IUPAC name is 3-[2-(3H-azepin-6-yl)piperidin-1-yl]sulfonyl-2H-pyrazolo[3,4-b]pyridine.
| Compound Name | 3-[2-(3H-azepin-6-yl)piperidin-1-yl]sulfonyl-2H-pyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 143465834 |
| Molecular Formula | C17H19N5O2S |
| Molecular Weight | 357.44 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 3-[2-(3H-azepin-6-yl)piperidin-1-yl]sulfonyl-2H-pyrazolo[3,4-b]pyridine |
| SMILES | O=S(=O)(c1[nH]nc2ncccc12)N1CCCCC1C1=CN=CCC=C1 |
| InChI | InChI=1S/C17H19N5O2S/c23-25(24,17-14-7-5-10-19-16(14)20-21-17)22-11-4-2-8-15(22)13-6-1-3-9-18-12-13/h1,5-7,9-10,12,15H,2-4,8,11H2,(H,19,20,21) |
| InChIKey | XNMOJAQGSRTDEK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.44 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |