C23H26FN5O7S — CID 143465950
N-[(4-fluoro-2-piperazin-1-ylsulfonylphenyl)methyl]-3'-hydroxy-4'-oxospiro[2,3-dihydropyran-4,9'-6,7-dihydropyrimido[2,1-c][1,4]oxazine]-2'-carboxamide (PubChem CID 143465950) has the molecular formula C23H26FN5O7S and a molecular weight of 535.55 g/mol. Its IUPAC name is N-[(4-fluoro-2-piperazin-1-ylsulfonylphenyl)methyl]-3'-hydroxy-4'-oxospiro[2,3-dihydropyran-4,9'-6,7-dihydropyrimido[2,1-c][1,4]oxazine]-2'-carboxamide.
| Compound Name | N-[(4-fluoro-2-piperazin-1-ylsulfonylphenyl)methyl]-3'-hydroxy-4'-oxospiro[2,3-dihydropyran-4,9'-6,7-dihydropyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
|---|---|
| PubChem CID | 143465950 |
| Molecular Formula | C23H26FN5O7S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 535.15 |
| IUPAC Name | N-[(4-fluoro-2-piperazin-1-ylsulfonylphenyl)methyl]-3'-hydroxy-4'-oxospiro[2,3-dihydropyran-4,9'-6,7-dihydropyrimido[2,1-c][1,4]oxazine]-2'-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1S(=O)(=O)N1CCNCC1)c1nc2n(c(=O)c1O)CCOC21C=COCC1 |
| InChI | InChI=1S/C23H26FN5O7S/c24-16-2-1-15(17(13-16)37(33,34)28-7-5-25-6-8-28)14-26-20(31)18-19(30)21(32)29-9-12-36-23(22(29)27-18)3-10-35-11-4-23/h1-3,10,13,25,30H,4-9,11-12,14H2,(H,26,31) |
| InChIKey | RODMHVKKYIKWQD-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 152.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |