C20H19FN6O5 — CID 54706509
N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxolane]-2-carboxamide (PubChem CID 54706509) has the molecular formula C20H19FN6O5 and a molecular weight of 442.41 g/mol. Its IUPAC name is N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxolane]-2-carboxamide.
| Compound Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxolane]-2-carboxamide |
|---|---|
| PubChem CID | 54706509 |
| Molecular Formula | C20H19FN6O5 |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.14 |
| IUPAC Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxolane]-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1-n1cncn1)c1nc2n(c(=O)c1O)CCOC21CCOC1 |
| InChI | InChI=1S/C20H19FN6O5/c21-13-2-1-12(14(7-13)27-11-22-10-24-27)8-23-17(29)15-16(28)18(30)26-4-6-32-20(19(26)25-15)3-5-31-9-20/h1-2,7,10-11,28H,3-6,8-9H2,(H,23,29) |
| InChIKey | ULWROHWVUMKBBC-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |