C19H19FN6O4 — CID 54717405
N-[[5-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide (PubChem CID 54717405) has the molecular formula C19H19FN6O4 and a molecular weight of 414.40 g/mol. Its IUPAC name is N-[[5-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide.
| Compound Name | N-[[5-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 54717405 |
| Molecular Formula | C19H19FN6O4 |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 414.15 |
| IUPAC Name | N-[[5-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
| SMILES | CC1(C)OCCn2c1nc(C(=O)NCc1cc(F)ccc1-n1cncn1)c(O)c2=O |
| InChI | InChI=1S/C19H19FN6O4/c1-19(2)18-24-14(15(27)17(29)25(18)5-6-30-19)16(28)22-8-11-7-12(20)3-4-13(11)26-10-21-9-23-26/h3-4,7,9-10,27H,5-6,8H2,1-2H3,(H,22,28) |
| InChIKey | AAAMHSPKAAFLLH-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 124.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |