C19H17FN6O5 — CID 54680885
N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxetane]-2-carboxamide (PubChem CID 54680885) has the molecular formula C19H17FN6O5 and a molecular weight of 428.38 g/mol. Its IUPAC name is N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxetane]-2-carboxamide.
| Compound Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxetane]-2-carboxamide |
|---|---|
| PubChem CID | 54680885 |
| Molecular Formula | C19H17FN6O5 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-[[4-fluoro-2-(1,2,4-triazol-1-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,3'-oxetane]-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1-n1cncn1)c1nc2n(c(=O)c1O)CCOC21COC1 |
| InChI | InChI=1S/C19H17FN6O5/c20-12-2-1-11(13(5-12)26-10-21-9-23-26)6-22-16(28)14-15(27)17(29)25-3-4-31-19(7-30-8-19)18(25)24-14/h1-2,5,9-10,27H,3-4,6-8H2,(H,22,28) |
| InChIKey | ZHBBXKKAMVKPGD-UHFFFAOYSA-N |
| XLogP | -0.15 |
| TPSA | 133.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |