C23H27FN4O7S — CID 54706922
N-[[2-(1,1-dioxothiazinan-2-yl)-4-fluorophenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide (PubChem CID 54706922) has the molecular formula C23H27FN4O7S and a molecular weight of 522.56 g/mol. Its IUPAC name is N-[[2-(1,1-dioxothiazinan-2-yl)-4-fluorophenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide.
| Compound Name | N-[[2-(1,1-dioxothiazinan-2-yl)-4-fluorophenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide |
|---|---|
| PubChem CID | 54706922 |
| Molecular Formula | C23H27FN4O7S |
| Molecular Weight | 522.56 g/mol |
| Exact Mass | 522.16 |
| IUPAC Name | N-[[2-(1,1-dioxothiazinan-2-yl)-4-fluorophenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,4'-oxane]-2-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1N1CCCCS1(=O)=O)c1nc2n(c(=O)c1O)CCOC21CCOCC1 |
| InChI | InChI=1S/C23H27FN4O7S/c24-16-4-3-15(17(13-16)28-7-1-2-12-36(28,32)33)14-25-20(30)18-19(29)21(31)27-8-11-35-23(22(27)26-18)5-9-34-10-6-23/h3-4,13,29H,1-2,5-12,14H2,(H,25,30) |
| InChIKey | QCOFUABBVCEDEU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 140.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.56 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |