C23H28N4O6S — CID 54683925
N-[[2-(1,1-dioxothiazinan-2-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,1'-cyclopentane]-2-carboxamide (PubChem CID 54683925) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is N-[[2-(1,1-dioxothiazinan-2-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,1'-cyclopentane]-2-carboxamide.
| Compound Name | N-[[2-(1,1-dioxothiazinan-2-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,1'-cyclopentane]-2-carboxamide |
|---|---|
| PubChem CID | 54683925 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[[2-(1,1-dioxothiazinan-2-yl)phenyl]methyl]-3-hydroxy-4-oxospiro[6,7-dihydropyrimido[2,1-c][1,4]oxazine-9,1'-cyclopentane]-2-carboxamide |
| SMILES | O=C(NCc1ccccc1N1CCCCS1(=O)=O)c1nc2n(c(=O)c1O)CCOC21CCCC1 |
| InChI | InChI=1S/C23H28N4O6S/c28-19-18(25-22-23(9-3-4-10-23)33-13-12-26(22)21(19)30)20(29)24-15-16-7-1-2-8-17(16)27-11-5-6-14-34(27,31)32/h1-2,7-8,28H,3-6,9-15H2,(H,24,29) |
| InChIKey | NARVGNRGPSDJOC-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |