C21H27FN4O6S — CID 69280205
N-[[2-(1,1-dihydroxythiazinan-2-yl)-3-fluorophenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide (PubChem CID 69280205) has the molecular formula C21H27FN4O6S and a molecular weight of 482.53 g/mol. Its IUPAC name is N-[[2-(1,1-dihydroxythiazinan-2-yl)-3-fluorophenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide.
| Compound Name | N-[[2-(1,1-dihydroxythiazinan-2-yl)-3-fluorophenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
|---|---|
| PubChem CID | 69280205 |
| Molecular Formula | C21H27FN4O6S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | N-[[2-(1,1-dihydroxythiazinan-2-yl)-3-fluorophenyl]methyl]-3-hydroxy-9,9-dimethyl-4-oxo-6,7-dihydropyrimido[2,1-c][1,4]oxazine-2-carboxamide |
| SMILES | CC1(C)OCCn2c1nc(C(=O)NCc1cccc(F)c1N1CCCCS1(O)O)c(O)c2=O |
| InChI | InChI=1S/C21H27FN4O6S/c1-21(2)20-24-15(17(27)19(29)25(20)9-10-32-21)18(28)23-12-13-6-5-7-14(22)16(13)26-8-3-4-11-33(26,30)31/h5-7,27,30-31H,3-4,8-12H2,1-2H3,(H,23,28) |
| InChIKey | LFKJCKCBIBCDQO-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 137.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |