C26H33NO7 — CID 143466097
5-[11-[(2-aminophenyl)methoxy]-11-oxoundecoxy]benzene-1,3-dicarboxylic acid (PubChem CID 143466097) has the molecular formula C26H33NO7 and a molecular weight of 471.55 g/mol. Its IUPAC name is 5-[11-[(2-aminophenyl)methoxy]-11-oxoundecoxy]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[11-[(2-aminophenyl)methoxy]-11-oxoundecoxy]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 143466097 |
| Molecular Formula | C26H33NO7 |
| Molecular Weight | 471.55 g/mol |
| Exact Mass | 471.23 |
| IUPAC Name | 5-[11-[(2-aminophenyl)methoxy]-11-oxoundecoxy]benzene-1,3-dicarboxylic acid |
| SMILES | Nc1ccccc1COC(=O)CCCCCCCCCCOc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C26H33NO7/c27-23-12-9-8-11-19(23)18-34-24(28)13-7-5-3-1-2-4-6-10-14-33-22-16-20(25(29)30)15-21(17-22)26(31)32/h8-9,11-12,15-17H,1-7,10,13-14,18,27H2,(H,29,30)(H,31,32) |
| InChIKey | JZOSCZWWZOAJHH-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 136.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.55 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|