C21H20FNO3 — CID 143467126
3-(2-benzyl-5-fluoro-3,4-dimethoxyphenoxy)aniline (PubChem CID 143467126) has the molecular formula C21H20FNO3 and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-(2-benzyl-5-fluoro-3,4-dimethoxyphenoxy)aniline.
| Compound Name | 3-(2-benzyl-5-fluoro-3,4-dimethoxyphenoxy)aniline |
|---|---|
| PubChem CID | 143467126 |
| Molecular Formula | C21H20FNO3 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | 3-(2-benzyl-5-fluoro-3,4-dimethoxyphenoxy)aniline |
| SMILES | COc1c(F)cc(Oc2cccc(N)c2)c(Cc2ccccc2)c1OC |
| InChI | InChI=1S/C21H20FNO3/c1-24-20-17(11-14-7-4-3-5-8-14)19(13-18(22)21(20)25-2)26-16-10-6-9-15(23)12-16/h3-10,12-13H,11,23H2,1-2H3 |
| InChIKey | QNRNCMYTNJITFK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|