C21H44N4 — CID 143467520
(Z)-4-[amino(cyclohexylmethyl)amino]-N-(cyclohexylmethyl)hex-2-en-1-amine;methanamine (PubChem CID 143467520) has the molecular formula C21H44N4 and a molecular weight of 352.61 g/mol. Its IUPAC name is (Z)-4-[amino(cyclohexylmethyl)amino]-N-(cyclohexylmethyl)hex-2-en-1-amine;methanamine.
| Compound Name | (Z)-4-[amino(cyclohexylmethyl)amino]-N-(cyclohexylmethyl)hex-2-en-1-amine;methanamine |
|---|---|
| PubChem CID | 143467520 |
| Molecular Formula | C21H44N4 |
| Molecular Weight | 352.61 g/mol |
| Exact Mass | 352.36 |
| IUPAC Name | (Z)-4-[amino(cyclohexylmethyl)amino]-N-(cyclohexylmethyl)hex-2-en-1-amine;methanamine |
| SMILES | CCC(/C=C\CNCC1CCCCC1)N(N)CC1CCCCC1.CN |
| InChI | InChI=1S/C20H39N3.CH5N/c1-2-20(23(21)17-19-12-7-4-8-13-19)14-9-15-22-16-18-10-5-3-6-11-18;1-2/h9,14,18-20,22H,2-8,10-13,15-17,21H2,1H3;2H2,1H3/b14-9-; |
| InChIKey | UWDSWRREHVJJBW-WQRRWHLMSA-N |
| XLogP | 3.82 |
| TPSA | 67.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.61 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|