C12H23N3 — CID 143438303
4-(2,6-dimethyl-3,6-dihydro-1H-pyridazin-3-yl)cyclohexan-1-amine (PubChem CID 143438303) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 4-(2,6-dimethyl-3,6-dihydro-1H-pyridazin-3-yl)cyclohexan-1-amine.
| Compound Name | 4-(2,6-dimethyl-3,6-dihydro-1H-pyridazin-3-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 143438303 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 4-(2,6-dimethyl-3,6-dihydro-1H-pyridazin-3-yl)cyclohexan-1-amine |
| SMILES | CC1C=CC(C2CCC(N)CC2)N(C)N1 |
| InChI | InChI=1S/C12H23N3/c1-9-3-8-12(15(2)14-9)10-4-6-11(13)7-5-10/h3,8-12,14H,4-7,13H2,1-2H3 |
| InChIKey | VBYIIDQGUAWGPU-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|