About 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline
2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline (PubChem CID 143467625) has the molecular formula C15H17NOS
and a molecular weight of 259.37 g/mol. Its IUPAC name is 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline.
Molecular Properties
| Compound Name | 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline |
| PubChem CID | 143467625 |
| Molecular Formula | C15H17NOS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline |
| SMILES | C=S(=O)(Nc1ccccc1C)c1ccccc1C |
| InChI | InChI=1S/C15H17NOS/c1-12-8-4-6-10-14(12)16-18(3,17)15-11-7-5-9-13(15)2/h4-11H,3H2,1-2H3,(H,16,17) |
| InChIKey | AFQUKEBEPRRYMU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline?
The IUPAC name of 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline (CID 143467625) is 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline.
What is the SMILES notation for 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline?
The canonical SMILES for 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline is C=S(=O)(Nc1ccccc1C)c1ccccc1C.
What is the InChIKey of 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline?
The InChIKey is AFQUKEBEPRRYMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H17NOS/c1-12-8-4-6-10-14(12)16-18(3,17)15-11-7-5-9-13(15)2/h4-11H,3H2,1-2H3,(H,16,17).
What are the key properties of 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline?
2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline has a molecular weight of 259.37 g/mol, XLogP of 3.41, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-N-[methylidene-(2-methylphenyl)-oxo-λ6-sulfanyl]aniline is sourced from PubChem (CID 143467625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).