C15H17N3O6S2 — CID 90121515
N,N'-bis(2-methylphenyl)-1-nitromethanedisulfonamide (PubChem CID 90121515) has the molecular formula C15H17N3O6S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is N,N'-bis(2-methylphenyl)-1-nitromethanedisulfonamide.
| Compound Name | N,N'-bis(2-methylphenyl)-1-nitromethanedisulfonamide |
|---|---|
| PubChem CID | 90121515 |
| Molecular Formula | C15H17N3O6S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | N,N'-bis(2-methylphenyl)-1-nitromethanedisulfonamide |
| SMILES | Cc1ccccc1NS(=O)(=O)C([N+](=O)[O-])S(=O)(=O)Nc1ccccc1C |
| InChI | InChI=1S/C15H17N3O6S2/c1-11-7-3-5-9-13(11)16-25(21,22)15(18(19)20)26(23,24)17-14-10-6-4-8-12(14)2/h3-10,15-17H,1-2H3 |
| InChIKey | GIDWMBUTTXTTJN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 135.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|