C23H24N4O2 — CID 143468695
5-[[2-[(benzylamino)methyl]-7-methylquinolin-6-yl]methyl]-1-methylimidazolidine-2,4-dione (PubChem CID 143468695) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is 5-[[2-[(benzylamino)methyl]-7-methylquinolin-6-yl]methyl]-1-methylimidazolidine-2,4-dione.
| Compound Name | 5-[[2-[(benzylamino)methyl]-7-methylquinolin-6-yl]methyl]-1-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 143468695 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | 5-[[2-[(benzylamino)methyl]-7-methylquinolin-6-yl]methyl]-1-methylimidazolidine-2,4-dione |
| SMILES | Cc1cc2nc(CNCc3ccccc3)ccc2cc1CC1C(=O)NC(=O)N1C |
| InChI | InChI=1S/C23H24N4O2/c1-15-10-20-17(11-18(15)12-21-22(28)26-23(29)27(21)2)8-9-19(25-20)14-24-13-16-6-4-3-5-7-16/h3-11,21,24H,12-14H2,1-2H3,(H,26,28,29) |
| InChIKey | GUIIIBISWJVPDZ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|