C20H21N5 — CID 143469271
1-[5-[(Z)-but-2-en-2-yl]-4-ethynyl-1H-pyrrol-2-yl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine (PubChem CID 143469271) has the molecular formula C20H21N5 and a molecular weight of 331.42 g/mol. Its IUPAC name is 1-[5-[(Z)-but-2-en-2-yl]-4-ethynyl-1H-pyrrol-2-yl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-[5-[(Z)-but-2-en-2-yl]-4-ethynyl-1H-pyrrol-2-yl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 143469271 |
| Molecular Formula | C20H21N5 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 1-[5-[(Z)-but-2-en-2-yl]-4-ethynyl-1H-pyrrol-2-yl]-3-cyclobutylimidazo[1,5-a]pyrazin-8-amine |
| SMILES | C#Cc1cc(-c2nc(C3CCC3)n3ccnc(N)c23)[nH]c1/C(C)=C\C |
| InChI | InChI=1S/C20H21N5/c1-4-12(3)16-13(5-2)11-15(23-16)17-18-19(21)22-9-10-25(18)20(24-17)14-7-6-8-14/h2,4,9-11,14,23H,6-8H2,1,3H3,(H2,21,22)/b12-4- |
| InChIKey | VDUWAKIVTQVHRZ-QCDXTXTGSA-N |
| XLogP | 3.98 |
| TPSA | 72.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|