C23H25ClN6 — CID 90798674
1-(7-chloro-1H-indol-2-yl)-3-[4-[(ethylideneamino)methyl]cyclohexyl]imidazo[1,5-a]pyrazin-8-amine (PubChem CID 90798674) has the molecular formula C23H25ClN6 and a molecular weight of 420.95 g/mol. Its IUPAC name is 1-(7-chloro-1H-indol-2-yl)-3-[4-[(ethylideneamino)methyl]cyclohexyl]imidazo[1,5-a]pyrazin-8-amine.
| Compound Name | 1-(7-chloro-1H-indol-2-yl)-3-[4-[(ethylideneamino)methyl]cyclohexyl]imidazo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 90798674 |
| Molecular Formula | C23H25ClN6 |
| Molecular Weight | 420.95 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-(7-chloro-1H-indol-2-yl)-3-[4-[(ethylideneamino)methyl]cyclohexyl]imidazo[1,5-a]pyrazin-8-amine |
| SMILES | C/C=N/CC1CCC(c2nc(-c3cc4cccc(Cl)c4[nH]3)c3c(N)nccn23)CC1 |
| InChI | InChI=1S/C23H25ClN6/c1-2-26-13-14-6-8-15(9-7-14)23-29-20(21-22(25)27-10-11-30(21)23)18-12-16-4-3-5-17(24)19(16)28-18/h2-5,10-12,14-15,28H,6-9,13H2,1H3,(H2,25,27)/b26-2+ |
| InChIKey | JXTDGTOLCVSULL-CKIAUBSUSA-N |
| XLogP | 5.48 |
| TPSA | 84.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.95 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|