C10H18O3 — CID 143470078
(2Z,5Z)-1,2,3-trimethoxyhepta-2,5-diene (PubChem CID 143470078) has the molecular formula C10H18O3 and a molecular weight of 186.25 g/mol. Its IUPAC name is (2Z,5Z)-1,2,3-trimethoxyhepta-2,5-diene.
| Compound Name | (2Z,5Z)-1,2,3-trimethoxyhepta-2,5-diene |
|---|---|
| PubChem CID | 143470078 |
| Molecular Formula | C10H18O3 |
| Molecular Weight | 186.25 g/mol |
| Exact Mass | 186.13 |
| IUPAC Name | (2Z,5Z)-1,2,3-trimethoxyhepta-2,5-diene |
| SMILES | C/C=C\C/C(OC)=C(\COC)OC |
| InChI | InChI=1S/C10H18O3/c1-5-6-7-9(12-3)10(13-4)8-11-2/h5-6H,7-8H2,1-4H3/b6-5-,10-9- |
| InChIKey | GJRPWUJZPUEEQW-WBHJMADESA-N |
| XLogP | 2.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.25 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|