C28H26F4N8O3 — CID 143471117
N'-[5-fluoro-4-(1,4-oxazepan-4-yl)pyrimidin-2-yl]-5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide (PubChem CID 143471117) has the molecular formula C28H26F4N8O3 and a molecular weight of 598.56 g/mol. Its IUPAC name is N'-[5-fluoro-4-(1,4-oxazepan-4-yl)pyrimidin-2-yl]-5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide.
| Compound Name | N'-[5-fluoro-4-(1,4-oxazepan-4-yl)pyrimidin-2-yl]-5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide |
|---|---|
| PubChem CID | 143471117 |
| Molecular Formula | C28H26F4N8O3 |
| Molecular Weight | 598.56 g/mol |
| Exact Mass | 598.21 |
| IUPAC Name | N'-[5-fluoro-4-(1,4-oxazepan-4-yl)pyrimidin-2-yl]-5-[3-(3-hydroxyanilino)-5-(trifluoromethyl)anilino]pyridine-2-carbohydrazide |
| SMILES | O=C(NNc1ncc(F)c(N2CCCOCC2)n1)c1ccc(Nc2cc(Nc3cccc(O)c3)cc(C(F)(F)F)c2)cn1 |
| InChI | InChI=1S/C28H26F4N8O3/c29-23-16-34-27(37-25(23)40-7-2-9-43-10-8-40)39-38-26(42)24-6-5-19(15-33-24)36-21-12-17(28(30,31)32)11-20(13-21)35-18-3-1-4-22(41)14-18/h1,3-6,11-16,35-36,41H,2,7-10H2,(H,38,42)(H,34,37,39) |
| InChIKey | YEIGRBYWHWDIPC-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 136.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.56 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|