C25H28ClF4N5O3 — CID 143471272
3-chloro-N'-[4-(diethylamino)-5-fluoropyrimidin-2-yl]-2-hydroxy-4-[3-(trifluoromethyl)phenyl]benzohydrazide;methoxyethane (PubChem CID 143471272) has the molecular formula C25H28ClF4N5O3 and a molecular weight of 557.98 g/mol. Its IUPAC name is 3-chloro-N'-[4-(diethylamino)-5-fluoropyrimidin-2-yl]-2-hydroxy-4-[3-(trifluoromethyl)phenyl]benzohydrazide;methoxyethane.
| Compound Name | 3-chloro-N'-[4-(diethylamino)-5-fluoropyrimidin-2-yl]-2-hydroxy-4-[3-(trifluoromethyl)phenyl]benzohydrazide;methoxyethane |
|---|---|
| PubChem CID | 143471272 |
| Molecular Formula | C25H28ClF4N5O3 |
| Molecular Weight | 557.98 g/mol |
| Exact Mass | 557.18 |
| IUPAC Name | 3-chloro-N'-[4-(diethylamino)-5-fluoropyrimidin-2-yl]-2-hydroxy-4-[3-(trifluoromethyl)phenyl]benzohydrazide;methoxyethane |
| SMILES | CCN(CC)c1nc(NNC(=O)c2ccc(-c3cccc(C(F)(F)F)c3)c(Cl)c2O)ncc1F.CCOC |
| InChI | InChI=1S/C22H20ClF4N5O2.C3H8O/c1-3-32(4-2)19-16(24)11-28-21(29-19)31-30-20(34)15-9-8-14(17(23)18(15)33)12-6-5-7-13(10-12)22(25,26)27;1-3-4-2/h5-11,33H,3-4H2,1-2H3,(H,30,34)(H,28,29,31);3H2,1-2H3 |
| InChIKey | ZAEJCYNSKYZMFV-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.98 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|