C21H23ClN2O2 — CID 58942537
1-[3-chloro-2-hydroxy-4-[5-(4-prop-2-enylcyclohexyl)pyrimidin-2-yl]phenyl]ethanone (PubChem CID 58942537) has the molecular formula C21H23ClN2O2 and a molecular weight of 370.88 g/mol. Its IUPAC name is 1-[3-chloro-2-hydroxy-4-[5-(4-prop-2-enylcyclohexyl)pyrimidin-2-yl]phenyl]ethanone.
| Compound Name | 1-[3-chloro-2-hydroxy-4-[5-(4-prop-2-enylcyclohexyl)pyrimidin-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58942537 |
| Molecular Formula | C21H23ClN2O2 |
| Molecular Weight | 370.88 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | 1-[3-chloro-2-hydroxy-4-[5-(4-prop-2-enylcyclohexyl)pyrimidin-2-yl]phenyl]ethanone |
| SMILES | C=CCC1CCC(c2cnc(-c3ccc(C(C)=O)c(O)c3Cl)nc2)CC1 |
| InChI | InChI=1S/C21H23ClN2O2/c1-3-4-14-5-7-15(8-6-14)16-11-23-21(24-12-16)18-10-9-17(13(2)25)20(26)19(18)22/h3,9-12,14-15,26H,1,4-8H2,2H3 |
| InChIKey | FHPWULDJMMAMLK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 63.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.88 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|