C10H13ClN2OS — CID 143471441
1-(4-chloro-2-hydroxyphenyl)propyl carbamimidothioate (PubChem CID 143471441) has the molecular formula C10H13ClN2OS and a molecular weight of 244.75 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxyphenyl)propyl carbamimidothioate.
| Compound Name | 1-(4-chloro-2-hydroxyphenyl)propyl carbamimidothioate |
|---|---|
| PubChem CID | 143471441 |
| Molecular Formula | C10H13ClN2OS |
| Molecular Weight | 244.75 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 1-(4-chloro-2-hydroxyphenyl)propyl carbamimidothioate |
| SMILES | [H]/N=C(\N)SC(CC)c1ccc(Cl)cc1O |
| InChI | InChI=1S/C10H13ClN2OS/c1-2-9(15-10(12)13)7-4-3-6(11)5-8(7)14/h3-5,9,14H,2H2,1H3,(H3,12,13) |
| InChIKey | XOGZVFSPFAIHKZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 70.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.75 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|