C9H11Cl3N2S — CID 158109227
1-(2,4-dichlorophenyl)ethyl carbamimidothioate;hydrochloride (PubChem CID 158109227) has the molecular formula C9H11Cl3N2S and a molecular weight of 285.63 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)ethyl carbamimidothioate;hydrochloride.
| Compound Name | 1-(2,4-dichlorophenyl)ethyl carbamimidothioate;hydrochloride |
|---|---|
| PubChem CID | 158109227 |
| Molecular Formula | C9H11Cl3N2S |
| Molecular Weight | 285.63 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | 1-(2,4-dichlorophenyl)ethyl carbamimidothioate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)SC(C)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C9H10Cl2N2S.ClH/c1-5(14-9(12)13)7-3-2-6(10)4-8(7)11;/h2-5H,1H3,(H3,12,13);1H |
| InChIKey | HKLBBDNDXCCKCL-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.63 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|