C24H30O3 — CID 143472658
3-[4-[2-[2-(4-ethylphenyl)-2-oxoethyl]pentyl]phenyl]propanoic acid (PubChem CID 143472658) has the molecular formula C24H30O3 and a molecular weight of 366.50 g/mol. Its IUPAC name is 3-[4-[2-[2-(4-ethylphenyl)-2-oxoethyl]pentyl]phenyl]propanoic acid.
| Compound Name | 3-[4-[2-[2-(4-ethylphenyl)-2-oxoethyl]pentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 143472658 |
| Molecular Formula | C24H30O3 |
| Molecular Weight | 366.50 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | 3-[4-[2-[2-(4-ethylphenyl)-2-oxoethyl]pentyl]phenyl]propanoic acid |
| SMILES | CCCC(CC(=O)c1ccc(CC)cc1)Cc1ccc(CCC(=O)O)cc1 |
| InChI | InChI=1S/C24H30O3/c1-3-5-21(17-23(25)22-13-10-18(4-2)11-14-22)16-20-8-6-19(7-9-20)12-15-24(26)27/h6-11,13-14,21H,3-5,12,15-17H2,1-2H3,(H,26,27) |
| InChIKey | WRTWBSRMOKYMNN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.50 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |