C28H30ClF4N3O — CID 143473111
1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]nonyl]-3-(3-fluorophenyl)urea (PubChem CID 143473111) has the molecular formula C28H30ClF4N3O and a molecular weight of 536.01 g/mol. Its IUPAC name is 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]nonyl]-3-(3-fluorophenyl)urea.
| Compound Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]nonyl]-3-(3-fluorophenyl)urea |
|---|---|
| PubChem CID | 143473111 |
| Molecular Formula | C28H30ClF4N3O |
| Molecular Weight | 536.01 g/mol |
| Exact Mass | 535.20 |
| IUPAC Name | 1-[(1S)-1-(5-chloro-2-pyridinyl)-1-[3-(trifluoromethyl)phenyl]nonyl]-3-(3-fluorophenyl)urea |
| SMILES | CCCCCCCC[C@](NC(=O)Nc1cccc(F)c1)(c1cccc(C(F)(F)F)c1)c1ccc(Cl)cn1 |
| InChI | InChI=1S/C28H30ClF4N3O/c1-2-3-4-5-6-7-16-27(25-15-14-22(29)19-34-25,20-10-8-11-21(17-20)28(31,32)33)36-26(37)35-24-13-9-12-23(30)18-24/h8-15,17-19H,2-7,16H2,1H3,(H2,35,36,37)/t27-/m0/s1 |
| InChIKey | VZLLUZYNXPPRAI-MHZLTWQESA-N |
| XLogP | 8.71 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.01 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|