C16H22F4O — CID 143474899
1-fluoro-4-octan-4-yl-2-(2,2,2-trifluoroethoxy)benzene (PubChem CID 143474899) has the molecular formula C16H22F4O and a molecular weight of 306.34 g/mol. Its IUPAC name is 1-fluoro-4-octan-4-yl-2-(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-fluoro-4-octan-4-yl-2-(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 143474899 |
| Molecular Formula | C16H22F4O |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 1-fluoro-4-octan-4-yl-2-(2,2,2-trifluoroethoxy)benzene |
| SMILES | CCCCC(CCC)c1ccc(F)c(OCC(F)(F)F)c1 |
| InChI | InChI=1S/C16H22F4O/c1-3-5-7-12(6-4-2)13-8-9-14(17)15(10-13)21-11-16(18,19)20/h8-10,12H,3-7,11H2,1-2H3 |
| InChIKey | CVYRIKMIZYKYJN-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |