About 4-decan-3-yl-1,2-difluorobenzene
4-decan-3-yl-1,2-difluorobenzene (PubChem CID 129157108) has the molecular formula C16H24F2
and a molecular weight of 254.36 g/mol. Its IUPAC name is 4-decan-3-yl-1,2-difluorobenzene.
Molecular Properties
| Compound Name | 4-decan-3-yl-1,2-difluorobenzene |
| PubChem CID | 129157108 |
| Molecular Formula | C16H24F2 |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 4-decan-3-yl-1,2-difluorobenzene |
| SMILES | CCCCCCCC(CC)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C16H24F2/c1-3-5-6-7-8-9-13(4-2)14-10-11-15(17)16(18)12-14/h10-13H,3-9H2,1-2H3 |
| InChIKey | CXKFNJXWEDUUAU-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-decan-3-yl-1,2-difluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-decan-3-yl-1,2-difluorobenzene?
The IUPAC name of 4-decan-3-yl-1,2-difluorobenzene (CID 129157108) is 4-decan-3-yl-1,2-difluorobenzene.
What is the SMILES notation for 4-decan-3-yl-1,2-difluorobenzene?
The canonical SMILES for 4-decan-3-yl-1,2-difluorobenzene is CCCCCCCC(CC)c1ccc(F)c(F)c1.
What is the InChIKey of 4-decan-3-yl-1,2-difluorobenzene?
The InChIKey is CXKFNJXWEDUUAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24F2/c1-3-5-6-7-8-9-13(4-2)14-10-11-15(17)16(18)12-14/h10-13H,3-9H2,1-2H3.
What are the key properties of 4-decan-3-yl-1,2-difluorobenzene?
4-decan-3-yl-1,2-difluorobenzene has a molecular weight of 254.36 g/mol, XLogP of 5.82, 8 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-decan-3-yl-1,2-difluorobenzene is sourced from PubChem (CID 129157108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).