About 2-octan-3-ylnaphthalene
2-octan-3-ylnaphthalene (PubChem CID 14029920) has the molecular formula C18H24
and a molecular weight of 240.39 g/mol. Its IUPAC name is 2-octan-3-ylnaphthalene.
Molecular Properties
| Compound Name | 2-octan-3-ylnaphthalene |
| PubChem CID | 14029920 |
| Molecular Formula | C18H24 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.19 |
| IUPAC Name | 2-octan-3-ylnaphthalene |
| SMILES | CCCCCC(CC)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C18H24/c1-3-5-6-9-15(4-2)18-13-12-16-10-7-8-11-17(16)14-18/h7-8,10-15H,3-6,9H2,1-2H3 |
| InChIKey | MQRJOPUBOFDSSD-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-octan-3-ylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-octan-3-ylnaphthalene?
The IUPAC name of 2-octan-3-ylnaphthalene (CID 14029920) is 2-octan-3-ylnaphthalene.
What is the SMILES notation for 2-octan-3-ylnaphthalene?
The canonical SMILES for 2-octan-3-ylnaphthalene is CCCCCC(CC)c1ccc2ccccc2c1.
What is the InChIKey of 2-octan-3-ylnaphthalene?
The InChIKey is MQRJOPUBOFDSSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24/c1-3-5-6-9-15(4-2)18-13-12-16-10-7-8-11-17(16)14-18/h7-8,10-15H,3-6,9H2,1-2H3.
What are the key properties of 2-octan-3-ylnaphthalene?
2-octan-3-ylnaphthalene has a molecular weight of 240.39 g/mol, XLogP of 5.91, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octan-3-ylnaphthalene is sourced from PubChem (CID 14029920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).