C23H32N2OS — CID 175370376
N-carbamothioyl-3-naphthalen-2-yldodecanamide (PubChem CID 175370376) has the molecular formula C23H32N2OS and a molecular weight of 384.59 g/mol. Its IUPAC name is N-carbamothioyl-3-naphthalen-2-yldodecanamide.
| Compound Name | N-carbamothioyl-3-naphthalen-2-yldodecanamide |
|---|---|
| PubChem CID | 175370376 |
| Molecular Formula | C23H32N2OS |
| Molecular Weight | 384.59 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-carbamothioyl-3-naphthalen-2-yldodecanamide |
| SMILES | CCCCCCCCCC(CC(=O)NC(N)=S)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H32N2OS/c1-2-3-4-5-6-7-8-12-20(17-22(26)25-23(24)27)21-15-14-18-11-9-10-13-19(18)16-21/h9-11,13-16,20H,2-8,12,17H2,1H3,(H3,24,25,26,27) |
| InChIKey | JFQFETQPBSUWPO-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.59 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|