C19H29F3 — CID 59882257
1,2,3-trifluoro-5-(10-methyldodecan-3-yl)benzene (PubChem CID 59882257) has the molecular formula C19H29F3 and a molecular weight of 314.44 g/mol. Its IUPAC name is 1,2,3-trifluoro-5-(10-methyldodecan-3-yl)benzene.
| Compound Name | 1,2,3-trifluoro-5-(10-methyldodecan-3-yl)benzene |
|---|---|
| PubChem CID | 59882257 |
| Molecular Formula | C19H29F3 |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | 1,2,3-trifluoro-5-(10-methyldodecan-3-yl)benzene |
| SMILES | CCC(C)CCCCCCC(CC)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H29F3/c1-4-14(3)10-8-6-7-9-11-15(5-2)16-12-17(20)19(22)18(21)13-16/h12-15H,4-11H2,1-3H3 |
| InChIKey | NEBQFQBEBYJZPH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|