C23H29FN2O — CID 143475025
2-(2-ethyl-3-fluorophenyl)-5,6-dimethyl-3-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]pyrimidin-4-one (PubChem CID 143475025) has the molecular formula C23H29FN2O and a molecular weight of 368.50 g/mol. Its IUPAC name is 2-(2-ethyl-3-fluorophenyl)-5,6-dimethyl-3-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]pyrimidin-4-one.
| Compound Name | 2-(2-ethyl-3-fluorophenyl)-5,6-dimethyl-3-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 143475025 |
| Molecular Formula | C23H29FN2O |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.23 |
| IUPAC Name | 2-(2-ethyl-3-fluorophenyl)-5,6-dimethyl-3-[(Z)-3-[(Z)-prop-1-enyl]hex-3-enyl]pyrimidin-4-one |
| SMILES | C/C=C\C(=C/CC)CCn1c(-c2cccc(F)c2CC)nc(C)c(C)c1=O |
| InChI | InChI=1S/C23H29FN2O/c1-6-10-18(11-7-2)14-15-26-22(25-17(5)16(4)23(26)27)20-12-9-13-21(24)19(20)8-3/h6,9-13H,7-8,14-15H2,1-5H3/b10-6-,18-11+ |
| InChIKey | FCFRURCZYUOZQN-REMORQKGSA-N |
| XLogP | 5.53 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|