C23H21FN2OS — CID 143475184
2-(3-fluorophenyl)-6-methyl-5-phenyl-3-[(3Z)-3-sulfanylhexa-3,5-dienyl]pyrimidin-4-one (PubChem CID 143475184) has the molecular formula C23H21FN2OS and a molecular weight of 392.50 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-6-methyl-5-phenyl-3-[(3Z)-3-sulfanylhexa-3,5-dienyl]pyrimidin-4-one.
| Compound Name | 2-(3-fluorophenyl)-6-methyl-5-phenyl-3-[(3Z)-3-sulfanylhexa-3,5-dienyl]pyrimidin-4-one |
|---|---|
| PubChem CID | 143475184 |
| Molecular Formula | C23H21FN2OS |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | 2-(3-fluorophenyl)-6-methyl-5-phenyl-3-[(3Z)-3-sulfanylhexa-3,5-dienyl]pyrimidin-4-one |
| SMILES | C=C/C=C(\S)CCn1c(-c2cccc(F)c2)nc(C)c(-c2ccccc2)c1=O |
| InChI | InChI=1S/C23H21FN2OS/c1-3-8-20(28)13-14-26-22(18-11-7-12-19(24)15-18)25-16(2)21(23(26)27)17-9-5-4-6-10-17/h3-12,15,28H,1,13-14H2,2H3/b20-8- |
| InChIKey | CBRRBXGKBVLILC-ZBKNUEDVSA-N |
| XLogP | 5.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|